2,3-Dihydro-1H-indene-5-sulfonyl chloride

Catalog No. :
ACIGRX563
CAS No. :
52205-85-3
Molecular Formula :
C9H9ClO2S
Molecular Weight :
216.69

IUPAC Name:2,3-dihydro-1H-indene-5-sulfonyl chloride

2,3-Dihydro-1H-indene-5-sulfonyl chloride structure diagram
Pack SizePurityList PriceYour PriceGlobal StockUS StockQuantity
5g98%$82.00Login to see priceIn stockIn stock
25g98%$406.00Login to see priceIn stockIn stock

Products of AiFChem are all designed for scientific research only. Under no circumstances do we provide products or services for animal or personal utilization.

Product Information

Product Name2,3-Dihydro-1H-indene-5-sulfonyl chloride
IUPAC Name2,3-dihydro-1H-indene-5-sulfonyl chloride
MDL No.MFCD05237217
Molecular FormulaC9H9ClO2S
Molecular Weight216.69
SMILESO=S(C1=CC2=C(CCC2)C=C1)(Cl)=O
InChI KeySWLIXMXSCZYVTQ-UHFFFAOYSA-N
SynonymFT-0677217 | indane-5-sulphonyl chloride | indan-5-sulfonyl chloride, AldrichCPR | 2,3-dihydro-1H-indene-5-sulfonyl chloride | indan-5-sulfonic acid chloride | SY079224 | A828978 | AT13425 | A808970 | EN300-11191 | indane-5-sulfonyl chloride | AKOS0001231
CAS No.52205-85-3
PubChem CID3142583

Synthetic Route by SureRoute

1. ACIGRX563 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. reactant_1 route compound structure diagram
    --
  2. Plus
  3. reactant_2 route compound structure diagram
    --
  4. Then
  5. ACIGRX563 route product structure diagram
    ACIGRX56352205-85-3 In Stock
Inquiry

2. ACIGRX563 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. reactant_1 route compound structure diagram
    --
  2. Plus
  3. reactant_2 route compound structure diagram
    --
  4. Plus
  5. reactant_3 route compound structure diagram
    --
  6. Then
  7. ACIGRX563 route product structure diagram
    ACIGRX56352205-85-3 In Stock
Inquiry

Comments (0)