2-Chloro-5-cyanophenylboronic acid

Catalog No. :
ACMJDY039
CAS No. :
936249-33-1
Molecular Formula :
C7H5BClNO2
Molecular Weight :
181.39

IUPAC Name:(2-chloro-5-cyanophenyl)boronic acid

2-Chloro-5-cyanophenylboronic acid structure diagram
Pack SizePurityList PriceYour PriceGlobal StockUS StockQuantity
5g98%$111.00Login to see priceIn stockIn stock
25g98%$507.00Login to see priceIn stockIn stock
100g98%$1611.00Login to see priceIn stockInquiry

Products of AiFChem are all designed for scientific research only. Under no circumstances do we provide products or services for animal or personal utilization.

Product Information

Product Name2-Chloro-5-cyanophenylboronic acid
IUPAC Name(2-chloro-5-cyanophenyl)boronic acid
MDL No.MFCD06656271
Molecular FormulaC7H5BClNO2
Molecular Weight181.39
SMILESOB(C1=CC(C#N)=CC=C1Cl)O
InChI KeyYNZXUVCJPQNYHR-UHFFFAOYSA-N
Synonym2-Chloro-5-cyanophenylboronic acid | 936249-33-1 | (2-chloro-5-cyanophenyl)boronic acid | 2-chloro-5-cyanobenzeneboronic acid | MFCD06656271 | [2-Chloro-5-cyanophenyl]boronic acid | (2-chloro-5-cyano-phenyl)boronic Acid | 2-Chloro-5-cyanophenylboronicacid | SCHEMBL134759
CAS No.936249-33-1
PubChem CID2763279

Synthetic Route by SureRoute

1. ACMJDY039 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. reactant_1 route compound structure diagram
    --
  2. Plus
  3. ACDRHP051 route compound structure diagram
    ACDRHP051774608-50-3 In Stock
  4. Then
  5. ACMJDY039 route product structure diagram
    ACMJDY039936249-33-1 In Stock
Inquiry

2. ACMJDY039 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. ACDRHP051 route compound structure diagram
    ACDRHP051774608-50-3 In Stock
  2. Plus
  3. ACFXPJ467 route compound structure diagram
    ACFXPJ46713963-58-1 In Stock
  4. Then
  5. ACMJDY039 route product structure diagram
    ACMJDY039936249-33-1 In Stock
Inquiry

Comments (0)