(2-Bromo-6-fluorophenyl)boronic acid

Catalog No. :
ACDJGQ236
CAS No. :
913835-80-0
Molecular Formula :
C6H5BBrFO2
Molecular Weight :
218.82

IUPAC Name:(2-bromo-6-fluorophenyl)boronic acid

(2-Bromo-6-fluorophenyl)boronic acid structure diagram
Pack SizePurityList PriceYour PriceGlobal StockUS StockQuantity
100g97%$127.00Login to see priceIn stockInquiry
500g97%$622.00Login to see priceIn stockInquiry
1000g97%$1107.00Login to see priceInquiryInquiry

Products of AiFChem are all designed for scientific research only. Under no circumstances do we provide products or services for animal or personal utilization.

Product Information

Product Name(2-Bromo-6-fluorophenyl)boronic acid
IUPAC Name(2-bromo-6-fluorophenyl)boronic acid
MDL No.MFCD05664309
Molecular FormulaC6H5BBrFO2
Molecular Weight218.82
SMILESFC1=C(B(O)O)C(Br)=CC=C1
InChI KeyMVSHYHSMIRBRGU-UHFFFAOYSA-N
SynonymAM808078 | MFCD05664309 | DS-2415 | BORONIC ACID, B-(2-BROMO-6-FLUOROPHENYL)- | DTXSID20584397 | Z1269142120 | EN300-261710 | (2-Bromo-6-fluorophenyl)boronicacid | SCHEMBL3313027 | 2-Bromo-6-fluorophenylboronic acid | AB22349 | CS-W014781 | FT-0653050 | A
CAS No.913835-80-0
PubChem CID16217456

Synthetic Route by SureRoute

1. ACDJGQ236 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. reactant_1 route compound structure diagram
    --
  2. Plus
  3. reactant_2 route compound structure diagram
    --
  4. Then
  5. ACDJGQ236 route product structure diagram
    ACDJGQ236913835-80-0 In Stock
Inquiry

2. ACDJGQ236 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. ACJEWS193 route compound structure diagram
    ACJEWS19318027-10-6 In Stock
  2. Plus
  3. reactant_2 route compound structure diagram
    --
  4. Then
  5. ACDJGQ236 route product structure diagram
    ACDJGQ236913835-80-0 In Stock
Inquiry

Comments (0)