2-(Methylthio)nicotinic acid

Catalog No. :
ACGAIV692
CAS No. :
74470-23-8
Molecular Formula :
C7H7NO2S
Molecular Weight :
169.21

IUPAC Name:2-(methylthio)nicotinic acid

2-(Methylthio)nicotinic acid structure diagram
Pack SizePurityList PriceYour PriceGlobal StockUS StockQuantity
25g98%$187.00Login to see priceIn stockIn stock
100g98%$695.00Login to see priceIn stockIn stock
500g98%$2884.00Login to see priceInquiryInquiry

Products of AiFChem are all designed for scientific research only. Under no circumstances do we provide products or services for animal or personal utilization.

Product Information

Product Name2-(Methylthio)nicotinic acid
IUPAC Name2-(methylthio)nicotinic acid
MDL No.MFCD00010101
Molecular FormulaC7H7NO2S
Molecular Weight169.21
SMILESO=C(C1=CC=CN=C1SC)O
InChI KeyCOPSJQVPEUUOKY-UHFFFAOYSA-N
Synonym2-(Methylthio)nicotinic acid | 74470-23-8 | 2-(methylsulfanyl)nicotinic acid | 2-(Methylthio)pyridine-3-carboxylic acid | 2-methylsulfanylpyridine-3-carboxylic acid | 2-methylmercaptonicotinic acid | 2-Methylthio-3-pyridinecarboxylic acid | MFCD00010101 | 3-Pyridinecarbo
CAS No.74470-23-8
PubChem CID262400

Synthetic Route by SureRoute

1. ACGAIV692 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. reactant_1 route compound structure diagram
    --
  2. Plus
  3. reactant_2 route compound structure diagram
    --
  4. Then
  5. ACGAIV692 route product structure diagram
    ACGAIV69274470-23-8 In Stock
Inquiry

2. ACGAIV692 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. reactant_1 route compound structure diagram
    --
  2. Plus
  3. reactant_2 route compound structure diagram
    --
  4. Then
  5. ACGAIV692 route product structure diagram
    ACGAIV69274470-23-8 In Stock
Inquiry

Comments (0)