2-Chloro-6-methoxynicotinic acid

Catalog No. :
ACOLSZ354
CAS No. :
503000-87-1
Molecular Formula :
C7H6ClNO3
Molecular Weight :
187.58

IUPAC Name:2-chloro-6-methoxynicotinic acid

2-Chloro-6-methoxynicotinic acid structure diagram
Pack SizePurityList PriceYour PriceGlobal StockUS StockQuantity
5g95%$105.00Login to see priceIn stockIn stock
25g95%$410.00Login to see priceIn stockIn stock
100g95%$1352.00Login to see priceIn stockInquiry

Products of AiFChem are all designed for scientific research only. Under no circumstances do we provide products or services for animal or personal utilization.

Product Information

Product Name2-Chloro-6-methoxynicotinic acid
IUPAC Name2-chloro-6-methoxynicotinic acid
MDL No.MFCD08236845
Molecular FormulaC7H6ClNO3
Molecular Weight187.58
SMILESO=C(O)C1=C(Cl)N=C(OC)C=C1
InChI KeyJPBUYRWPJMVZKX-UHFFFAOYSA-N
Synonym3-PYRIDINECARBOXYLIC ACID, 2-CHLORO-6-METHOXY- | EN300-147669 | A7465 | AB44161 | 2-chloro-6-methoxy pyridine-3-carboxylic acid | J-508953 | AKOS005073613 | 2-Chloro-6-MethoxynicotinicAcid | 2-chloro-6-methoxypyridine-3-carboxylic acid | CS-0108677 | AC-2
CAS No.503000-87-1
PubChem CID11769266

Synthetic Route by SureRoute

1. ACOLSZ354 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. ACQVKH312 route compound structure diagram
    ACQVKH3121184-54-9 In Stock
  2. Plus
  3. ACBJSC259 route compound structure diagram
    ACBJSC25938496-18-3 In Stock
  4. Then
  5. ACOLSZ354 route product structure diagram
    ACOLSZ354503000-87-1 In Stock
Inquiry

2. ACOLSZ354 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. ACQVKH312 route compound structure diagram
    ACQVKH3121184-54-9 In Stock
  2. Plus
  3. ACBJSC259 route compound structure diagram
    ACBJSC25938496-18-3 In Stock
  4. Plus
  5. reactant_3 route compound structure diagram
    --
  6. Then
  7. ACOLSZ354 route product structure diagram
    ACOLSZ354503000-87-1 In Stock
Inquiry

Comments (0)