Methyl 3-methoxy-2-methylbenzoate

Catalog No. :
ACFETY827
CAS No. :
42981-93-1
Molecular Formula :
C10H12O3
Molecular Weight :
180.20

IUPAC Name:methyl 3-methoxy-2-methylbenzoate

Methyl 3-methoxy-2-methylbenzoate structure diagram
Pack SizePurityList PriceYour PriceGlobal StockUS StockQuantity
25g98%$219.00Login to see priceIn stockIn stock
100g98%$839.00Login to see priceIn stockIn stock

Products of AiFChem are all designed for scientific research only. Under no circumstances do we provide products or services for animal or personal utilization.

Product Information

Product NameMethyl 3-methoxy-2-methylbenzoate
IUPAC Namemethyl 3-methoxy-2-methylbenzoate
MDL No.MFCD11846427
Molecular FormulaC10H12O3
Molecular Weight180.20
SMILESCOC(=O)C1=C(C)C(OC)=CC=C1
InChI KeyVVQORCPXLODREB-UHFFFAOYSA-N
SynonymMETHYL 3-METHOXY-2-METHYLBENZOATE | 42981-93-1 | MFCD11846427 | Methyl3-methoxy-2-methylbenzoate | SCHEMBL3796962 | DTXSID70501392 | VVQORCPXLODREB-UHFFFAOYSA-N | AMY30239 | AKOS015888698 | NF-0031 | SY258531 | CS-0199628 | FT-0753702 | Benzoicacid,3-methoxy-2-methyl-,methyl ester
CAS No.42981-93-1
PubChem CID12527049

Synthetic Route by SureRoute

1. ACFETY827 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. ACQVKH312 route compound structure diagram
    ACQVKH3121184-54-9 In Stock
  2. Plus
  3. ACNROA724 route compound structure diagram
    ACNROA72455289-06-0 In Stock
  4. Then
  5. ACFETY827 route product structure diagram
    ACFETY82742981-93-1 In Stock
Inquiry

2. ACFETY827 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. reactant_1 route compound structure diagram
    --
  2. Plus
  3. ACOXVW761 route compound structure diagram
    ACOXVW76155289-05-9 In Stock
  4. Then
  5. ACFETY827 route product structure diagram
    ACFETY82742981-93-1 In Stock
Inquiry

Comments (0)