5-Chloro-2-ethoxyphenylboronic acid

Catalog No. :
ACRNZL412
CAS No. :
352534-86-2
Molecular Formula :
C8H10BClO3
Molecular Weight :
200.43

IUPAC Name:(5-chloro-2-ethoxyphenyl)boronic acid

5-Chloro-2-ethoxyphenylboronic acid structure diagram
Pack SizePurityList PriceYour PriceGlobal StockUS StockQuantity
25g98%$60.00Login to see priceIn stockIn stock
100g98%$195.00Login to see priceIn stockIn stock
500g98%$764.00Login to see priceInquiryInquiry

Products of AiFChem are all designed for scientific research only. Under no circumstances do we provide products or services for animal or personal utilization.

Product Information

Product Name5-Chloro-2-ethoxyphenylboronic acid
IUPAC Name(5-chloro-2-ethoxyphenyl)boronic acid
MDL No.MFCD03427055
Molecular FormulaC8H10BClO3
Molecular Weight200.43
SMILESCCOC1=C(C=C(Cl)C=C1)B(O)O
InChI KeyOSMBQNBPCSSVMT-UHFFFAOYSA-N
SynonymPS-9771 | SY081493 | AB15046 | N11932 | 2-Ethoxy-5-chlorophenylboronic acid | 2-ethoxy-5-chloro-phenylboronic acid | C3210 | 5-Chloro-2-ethoxypheylboronic acid | FT-0644493 | 5-Chloro-2-ethoxyphenylboronic acid | 5-chloro-2-ethoxy-phenylboronic acid | SCH
CAS No.352534-86-2
PubChem CID3700836

Synthetic Route by SureRoute

1. ACRNZL412 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. reactant_1 route compound structure diagram
    --
  2. Plus
  3. ACACQJ537 route compound structure diagram
    ACACQJ53789488-25-5 In Stock
  4. Then
  5. ACRNZL412 route product structure diagram
    ACRNZL412352534-86-2 In Stock
Inquiry

2. ACRNZL412 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. reactant_1 route compound structure diagram
    --
  2. Plus
  3. ACACQJ537 route compound structure diagram
    ACACQJ53789488-25-5 In Stock
  4. Then
  5. ACRNZL412 route product structure diagram
    ACRNZL412352534-86-2 In Stock
Inquiry

Comments (0)