Propane-1,2,3-triyl tributyrate

Catalog No.: 
ACUMPI132
CAS No.: 
60-01-5
Molecular Formula: 
C15H26O6
Molecular Weight: 
302.37
Propane-1,2,3-triyl tributyrate structure diagram
Pack SizePurityList PriceYour PriceGlobal StockUS StockQuantity
500g98%$62.00In stockInquiry
1000g98%$105.00In stockInquiry

Products of AiFChem are all designed for scientific research only. Under no circumstances do we provide products or services for animal or personal utilization.

Product Information

Product NamePropane-1,2,3-triyl tributyrate
IUPAC Namepropane-1,2,3-triyl tributyrate
MDL No.MFCD00009392
Molecular FormulaC15H26O6
Molecular Weight302.37
SMILESCCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O
InChI KeyUYXTWWCETRIEDR-UHFFFAOYSA-N
Synonympropane-1,2,3-triyl tributanoate | Tox21_303991 | Butyric acid triester with glycerin | Tributin | BRN 1714746 | Glyceryl tributyrate | GLYCERYL TRI-BUTYRATE | Glyceryl tributyrate, >=99% | CS-W012120 | Glyceroltributyrin | Q4116129 | EINECS 200-451-5 | G
CAS No.60-01-5
PubChem CID6050

Synthetic Route by SureRoute

1. ACUMPI132 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. ACMGHB428 route compound structure diagram
    ACMGHB42899283-81-5In Stock
  2. Plus
  3. reactant_2 route compound structure diagram
    --
  4. Then
  5. ACUMPI132 route product structure diagram
    ACUMPI13260-01-5In Stock
Inquiry

2. ACUMPI132 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. reactant_1 route compound structure diagram
    --
  2. Plus
  3. reactant_2 route compound structure diagram
    --
  4. Then
  5. ACUMPI132 route product structure diagram
    ACUMPI13260-01-5In Stock
Inquiry

3. ACUMPI132 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. reactant_1 route compound structure diagram
    --
  2. Plus
  3. reactant_2 route compound structure diagram
    --
  4. Then
  5. ACUMPI132 route product structure diagram
    ACUMPI13260-01-5In Stock
Inquiry

Comments (0)