3-Benzyl-4-methylthiazol-3-ium chloride

Catalog No. :
ACXFJV381
CAS No. :
4209-18-1
Molecular Formula :
C11H12ClNS
Molecular Weight :
225.74

IUPAC Name:3-benzyl-4-methylthiazol-3-ium chloride

3-Benzyl-4-methylthiazol-3-ium chloride structure diagram
Pack SizePurityList PriceYour PriceGlobal StockUS StockQuantity
5g95%$76.00Login to see priceIn stockIn stock
25g95%$353.00Login to see priceIn stockIn stock
100g95%$1370.00Login to see priceInquiryInquiry

Products of AiFChem are all designed for scientific research only. Under no circumstances do we provide products or services for animal or personal utilization.

Product Information

Product Name3-Benzyl-4-methylthiazol-3-ium chloride
IUPAC Name3-benzyl-4-methylthiazol-3-ium chloride
MDL No.MFCD01318305
Molecular FormulaC11H12ClNS
Molecular Weight225.74
SMILESCC1=CSC=[N+]1CC2=CC=CC=C2.[Cl-]
InChI KeyZGBNEPNQIDHABT-UHFFFAOYSA-M
Synonym3-Benzyl-4-methylthiazol-3-ium chloride | B1940 | AS-64083 | 3-Benzyl-4-methylthiazol-3-iumchloride | 3-Benzyl-4-methylthiazolium Chloride | SCHEMBL3935033 | D88880 | CS-0182161 | DTXSID90489269 | 3-Benzyl-4-methyl-1,3-thiazol-3-ium chloride | MFCD0131830
CAS No.4209-18-1
PubChem CID12324835

Synthetic Route by SureRoute

1. ACXFJV381 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. reactant_1 route compound structure diagram
    --
  2. Plus
  3. reactant_2 route compound structure diagram
    --
  4. Then
  5. ACXFJV381 route product structure diagram
    ACXFJV3814209-18-1 In Stock
Inquiry

2. ACXFJV381 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. ACXFJV381 route compound structure diagram
    ACXFJV3814209-18-1 In Stock
  2. Plus
  3. reactant_2 route compound structure diagram
    --
  4. Then
  5. ACXFJV381 route product structure diagram
    ACXFJV3814209-18-1 In Stock
Inquiry

Comments (0)