2-((4-((7-Chloroquinolin-4-yl)amino)pentyl)(ethyl)amino)ethanol sulfate

Catalog No. :
ACYHPJ214
CAS No. :
747-36-4
Molecular Formula :
C18H28ClN3O5S
Molecular Weight :
433.96

IUPAC Name:2-((4-((7-chloroquinolin-4-yl)amino)pentyl)(ethyl)amino)ethan-1-ol sulfate

2-((4-((7-Chloroquinolin-4-yl)amino)pentyl)(ethyl)amino)ethanol sulfate structure diagram
Pack SizePurityList PriceYour PriceGlobal StockUS StockQuantity
25g99%$89.00Login to see priceIn stockInquiry
100g99%$353.00Login to see priceIn stockInquiry
500g99%$750.00Login to see priceIn stockInquiry

Products of AiFChem are all designed for scientific research only. Under no circumstances do we provide products or services for animal or personal utilization.

Product Information

Product Name2-((4-((7-Chloroquinolin-4-yl)amino)pentyl)(ethyl)amino)ethanol sulfate
IUPAC Name2-((4-((7-chloroquinolin-4-yl)amino)pentyl)(ethyl)amino)ethan-1-ol sulfate
MDL No.MFCD00078203
Molecular FormulaC18H28ClN3O5S
Molecular Weight433.96
SMILESCCN(CCO)CCCC(NC1=CC=NC2=CC(Cl)=CC=C12)C.O=S(O)(O)=O
InChI KeyJCBIVZZPXRZKTI-UHFFFAOYSA-N
SynonymHYDROXYCHLOROQUINE SULFATE | 747-36-4 | Hydroxychloroquine sulphate | Ercoquin | Plaquenil | 2-((4-((7-Chloroquinolin-4-yl)amino)pentyl)(ethyl)amino)ethanol sulfate | Plaquinol | Toremonil | Quensyl | Oxiklorin | Plaquenil sulfate | NSC 4375 | TCMDC-123987 | HCQ sulfate | NSC-4375 | E
CAS No.747-36-4
PubChem CID12947

Synthetic Route by SureRoute

1. ACYHPJ214 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. reactant_1 route compound structure diagram
    --
  2. Plus
  3. ACBKRY824 route compound structure diagram
    ACBKRY82486-98-6 In Stock
  4. Then
  5. ACYHPJ214 route product structure diagram
    ACYHPJ214747-36-4 In Stock
Inquiry

2. ACYHPJ214 Molecular Building Block Synthetic Route

Source: SureRouteAuthor: aifchem

  1. ACCPDI176 route compound structure diagram
    ACCPDI1764298-15-1 In Stock
  2. Plus
  3. reactant_2 route compound structure diagram
    --
  4. Then
  5. ACYHPJ214 route product structure diagram
    ACYHPJ214747-36-4 In Stock
Inquiry

Comments (0)